ChemNet > CAS > 69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
Nazwa produktu: |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
Synonimy |
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
MF |
C11H7N3O2S |
Masie cząsteczkowej |
245.2572 |
InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
Nr CAS |
69625-13-4 |
Struktury molekularnej |
|
Gęstość |
1.397g/cm3 |
Temperatura topnienia |
147℃ |
Temperatura wrzenia |
457.3°C at 760 mmHg |
Współczynnik załamania |
1.641 |
Temperatura zapłonu |
230.3°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|